C18H19OP — CID 134842657
3-methyl-1-phenyl-2-propylphosphindole 1-oxide (PubChem CID 134842657) has the molecular formula C18H19OP and a molecular weight of 282.32 g/mol. Its IUPAC name is 3-methyl-1-phenyl-2-propylphosphindole 1-oxide.
| Compound Name | 3-methyl-1-phenyl-2-propylphosphindole 1-oxide |
|---|---|
| PubChem CID | 134842657 |
| Molecular Formula | C18H19OP |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3-methyl-1-phenyl-2-propylphosphindole 1-oxide |
| SMILES | CCCC1=C(C)c2ccccc2P1(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19OP/c1-3-9-17-14(2)16-12-7-8-13-18(16)20(17,19)15-10-5-4-6-11-15/h4-8,10-13H,3,9H2,1-2H3 |
| InChIKey | IWRJNUXABBQUJD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|