C29H23O2P — CID 132600999
1-[4-[(1-oxo-1,3-diphenylphosphindol-2-yl)methyl]phenyl]ethanone (PubChem CID 132600999) has the molecular formula C29H23O2P and a molecular weight of 434.48 g/mol. Its IUPAC name is 1-[4-[(1-oxo-1,3-diphenylphosphindol-2-yl)methyl]phenyl]ethanone.
| Compound Name | 1-[4-[(1-oxo-1,3-diphenylphosphindol-2-yl)methyl]phenyl]ethanone |
|---|---|
| PubChem CID | 132600999 |
| Molecular Formula | C29H23O2P |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 1-[4-[(1-oxo-1,3-diphenylphosphindol-2-yl)methyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(CC2=C(c3ccccc3)c3ccccc3P2(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H23O2P/c1-21(30)23-18-16-22(17-19-23)20-28-29(24-10-4-2-5-11-24)26-14-8-9-15-27(26)32(28,31)25-12-6-3-7-13-25/h2-19H,20H2,1H3 |
| InChIKey | GVRYOLZWKGHPMF-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|