C19H14BO4P — CID 155666222
(5,10-dioxo-5-phenylacridophosphin-1-yl)boronic acid (PubChem CID 155666222) has the molecular formula C19H14BO4P and a molecular weight of 348.10 g/mol. Its IUPAC name is (5,10-dioxo-5-phenylacridophosphin-1-yl)boronic acid.
| Compound Name | (5,10-dioxo-5-phenylacridophosphin-1-yl)boronic acid |
|---|---|
| PubChem CID | 155666222 |
| Molecular Formula | C19H14BO4P |
| Molecular Weight | 348.10 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (5,10-dioxo-5-phenylacridophosphin-1-yl)boronic acid |
| SMILES | O=C1c2ccccc2P(=O)(c2ccccc2)c2cccc(B(O)O)c21 |
| InChI | InChI=1S/C19H14BO4P/c21-19-14-9-4-5-11-16(14)25(24,13-7-2-1-3-8-13)17-12-6-10-15(18(17)19)20(22)23/h1-12,22-23H |
| InChIKey | IQCCRTPUFPHINO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.10 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|