C34H24F6NOP — CID 140898953
5-[4-[3,5-bis(trifluoromethyl)phenyl]-2,5-dimethylphenyl]-10-phenylphenophosphazinine 10-oxide (PubChem CID 140898953) has the molecular formula C34H24F6NOP and a molecular weight of 607.53 g/mol. Its IUPAC name is 5-[4-[3,5-bis(trifluoromethyl)phenyl]-2,5-dimethylphenyl]-10-phenylphenophosphazinine 10-oxide.
| Compound Name | 5-[4-[3,5-bis(trifluoromethyl)phenyl]-2,5-dimethylphenyl]-10-phenylphenophosphazinine 10-oxide |
|---|---|
| PubChem CID | 140898953 |
| Molecular Formula | C34H24F6NOP |
| Molecular Weight | 607.53 g/mol |
| Exact Mass | 607.15 |
| IUPAC Name | 5-[4-[3,5-bis(trifluoromethyl)phenyl]-2,5-dimethylphenyl]-10-phenylphenophosphazinine 10-oxide |
| SMILES | Cc1cc(N2c3ccccc3P(=O)(c3ccccc3)c3ccccc32)c(C)cc1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C34H24F6NOP/c1-21-17-30(22(2)16-27(21)23-18-24(33(35,36)37)20-25(19-23)34(38,39)40)41-28-12-6-8-14-31(28)43(42,26-10-4-3-5-11-26)32-15-9-7-13-29(32)41/h3-20H,1-2H3 |
| InChIKey | DPLXNWSZJQUNNT-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.53 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|