C33H21F6NP2S2 — CID 139428903
11-methyl-8,14-diphenyl-8,14-bis(sulfanylidene)-5,17-bis(trifluoromethyl)-1-aza-8λ5,14λ5-diphosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 139428903) has the molecular formula C33H21F6NP2S2 and a molecular weight of 671.61 g/mol. Its IUPAC name is 11-methyl-8,14-diphenyl-8,14-bis(sulfanylidene)-5,17-bis(trifluoromethyl)-1-aza-8λ5,14λ5-diphosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 11-methyl-8,14-diphenyl-8,14-bis(sulfanylidene)-5,17-bis(trifluoromethyl)-1-aza-8λ5,14λ5-diphosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 139428903 |
| Molecular Formula | C33H21F6NP2S2 |
| Molecular Weight | 671.61 g/mol |
| Exact Mass | 671.05 |
| IUPAC Name | 11-methyl-8,14-diphenyl-8,14-bis(sulfanylidene)-5,17-bis(trifluoromethyl)-1-aza-8λ5,14λ5-diphosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | Cc1cc2c3c(c1)P(=S)(c1ccccc1)c1cc(C(F)(F)F)ccc1N3c1ccc(C(F)(F)F)cc1P2(=S)c1ccccc1 |
| InChI | InChI=1S/C33H21F6NP2S2/c1-20-16-29-31-30(17-20)42(44,24-10-6-3-7-11-24)28-19-22(33(37,38)39)13-15-26(28)40(31)25-14-12-21(32(34,35)36)18-27(25)41(29,43)23-8-4-2-5-9-23/h2-19H,1H3 |
| InChIKey | SGGSFQUKIQINNO-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.61 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|