C33H27NP2S2 — CID 139429074
4,11,18-trimethyl-8,14-diphenyl-8,14-bis(sulfanylidene)-1-aza-8λ5,14λ5-diphosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 139429074) has the molecular formula C33H27NP2S2 and a molecular weight of 563.67 g/mol. Its IUPAC name is 4,11,18-trimethyl-8,14-diphenyl-8,14-bis(sulfanylidene)-1-aza-8λ5,14λ5-diphosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 4,11,18-trimethyl-8,14-diphenyl-8,14-bis(sulfanylidene)-1-aza-8λ5,14λ5-diphosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 139429074 |
| Molecular Formula | C33H27NP2S2 |
| Molecular Weight | 563.67 g/mol |
| Exact Mass | 563.11 |
| IUPAC Name | 4,11,18-trimethyl-8,14-diphenyl-8,14-bis(sulfanylidene)-1-aza-8λ5,14λ5-diphosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | Cc1ccc2c(c1)N1c3cc(C)ccc3P(=S)(c3ccccc3)c3cc(C)cc(c31)P2(=S)c1ccccc1 |
| InChI | InChI=1S/C33H27NP2S2/c1-22-14-16-29-27(18-22)34-28-19-23(2)15-17-30(28)36(38,26-12-8-5-9-13-26)32-21-24(3)20-31(33(32)34)35(29,37)25-10-6-4-7-11-25/h4-21H,1-3H3 |
| InChIKey | WBNPJSPXSRISTL-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.67 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|