C41H35N2PS — CID 140919817
5,10-diphenyl-10-sulfanylidene-3-(2,7,9,9-tetramethylacridin-10-yl)phenophosphazinine (PubChem CID 140919817) has the molecular formula C41H35N2PS and a molecular weight of 618.79 g/mol. Its IUPAC name is 5,10-diphenyl-10-sulfanylidene-3-(2,7,9,9-tetramethylacridin-10-yl)phenophosphazinine.
| Compound Name | 5,10-diphenyl-10-sulfanylidene-3-(2,7,9,9-tetramethylacridin-10-yl)phenophosphazinine |
|---|---|
| PubChem CID | 140919817 |
| Molecular Formula | C41H35N2PS |
| Molecular Weight | 618.79 g/mol |
| Exact Mass | 618.23 |
| IUPAC Name | 5,10-diphenyl-10-sulfanylidene-3-(2,7,9,9-tetramethylacridin-10-yl)phenophosphazinine |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(C)ccc1N2c1ccc2c(c1)N(c1ccccc1)c1ccccc1P2(=S)c1ccccc1 |
| InChI | InChI=1S/C41H35N2PS/c1-28-19-22-35-33(25-28)41(3,4)34-26-29(2)20-23-36(34)43(35)31-21-24-40-38(27-31)42(30-13-7-5-8-14-30)37-17-11-12-18-39(37)44(40,45)32-15-9-6-10-16-32/h5-27H,1-4H3 |
| InChIKey | YJDAVUXEFLWTHR-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.79 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|