C37H35NO2P2 — CID 139429015
8,14-bis(3,5-dimethylphenyl)-5,11,17-trimethyl-1-aza-8λ5,14λ5-diphosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene 8,14-dioxide (PubChem CID 139429015) has the molecular formula C37H35NO2P2 and a molecular weight of 587.64 g/mol. Its IUPAC name is 8,14-bis(3,5-dimethylphenyl)-5,11,17-trimethyl-1-aza-8λ5,14λ5-diphosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene 8,14-dioxide.
| Compound Name | 8,14-bis(3,5-dimethylphenyl)-5,11,17-trimethyl-1-aza-8λ5,14λ5-diphosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene 8,14-dioxide |
|---|---|
| PubChem CID | 139429015 |
| Molecular Formula | C37H35NO2P2 |
| Molecular Weight | 587.64 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | 8,14-bis(3,5-dimethylphenyl)-5,11,17-trimethyl-1-aza-8λ5,14λ5-diphosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene 8,14-dioxide |
| SMILES | Cc1cc(C)cc(P2(=O)c3cc(C)ccc3N3c4ccc(C)cc4P(=O)(c4cc(C)cc(C)c4)c4cc(C)cc2c43)c1 |
| InChI | InChI=1S/C37H35NO2P2/c1-22-8-10-31-33(18-22)41(39,29-14-24(3)12-25(4)15-29)35-20-28(7)21-36-37(35)38(31)32-11-9-23(2)19-34(32)42(36,40)30-16-26(5)13-27(6)17-30/h8-21H,1-7H3 |
| InChIKey | UUYUJTMGWZLAGK-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.64 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|