C42H37NP2 — CID 139429005
8,14-bis(3,5-dimethylphenyl)-5,17-dimethyl-11-phenyl-1-aza-8,14-diphosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 139429005) has the molecular formula C42H37NP2 and a molecular weight of 617.71 g/mol. Its IUPAC name is 8,14-bis(3,5-dimethylphenyl)-5,17-dimethyl-11-phenyl-1-aza-8,14-diphosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 8,14-bis(3,5-dimethylphenyl)-5,17-dimethyl-11-phenyl-1-aza-8,14-diphosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 139429005 |
| Molecular Formula | C42H37NP2 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.24 |
| IUPAC Name | 8,14-bis(3,5-dimethylphenyl)-5,17-dimethyl-11-phenyl-1-aza-8,14-diphosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | Cc1cc(C)cc(P2c3cc(C)ccc3N3c4ccc(C)cc4P(c4cc(C)cc(C)c4)c4cc(-c5ccccc5)cc2c43)c1 |
| InChI | InChI=1S/C42H37NP2/c1-26-12-14-36-38(22-26)44(34-18-28(3)16-29(4)19-34)40-24-33(32-10-8-7-9-11-32)25-41-42(40)43(36)37-15-13-27(2)23-39(37)45(41)35-20-30(5)17-31(6)21-35/h7-25H,1-6H3 |
| InChIKey | NLEBUGWIKFMRFW-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|