C22H21NSe — CID 59573436
3-methyl-10-(2,4,6-trimethylphenyl)phenoselenazine (PubChem CID 59573436) has the molecular formula C22H21NSe and a molecular weight of 378.38 g/mol. Its IUPAC name is 3-methyl-10-(2,4,6-trimethylphenyl)phenoselenazine.
| Compound Name | 3-methyl-10-(2,4,6-trimethylphenyl)phenoselenazine |
|---|---|
| PubChem CID | 59573436 |
| Molecular Formula | C22H21NSe |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 3-methyl-10-(2,4,6-trimethylphenyl)phenoselenazine |
| SMILES | Cc1cc(C)c(N2c3ccccc3[Se]c3cc(C)ccc32)c(C)c1 |
| InChI | InChI=1S/C22H21NSe/c1-14-9-10-19-21(13-14)24-20-8-6-5-7-18(20)23(19)22-16(3)11-15(2)12-17(22)4/h5-13H,1-4H3 |
| InChIKey | DLBRJUBJQATYHW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|