C19H17NOSe — CID 59573417
9-(2,4,6-trimethylphenyl)furo[3,2-b][1,4]benzoselenazine (PubChem CID 59573417) has the molecular formula C19H17NOSe and a molecular weight of 354.31 g/mol. Its IUPAC name is 9-(2,4,6-trimethylphenyl)furo[3,2-b][1,4]benzoselenazine.
| Compound Name | 9-(2,4,6-trimethylphenyl)furo[3,2-b][1,4]benzoselenazine |
|---|---|
| PubChem CID | 59573417 |
| Molecular Formula | C19H17NOSe |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 9-(2,4,6-trimethylphenyl)furo[3,2-b][1,4]benzoselenazine |
| SMILES | Cc1cc(C)c(N2c3ccccc3[Se]c3ccoc32)c(C)c1 |
| InChI | InChI=1S/C19H17NOSe/c1-12-10-13(2)18(14(3)11-12)20-15-6-4-5-7-16(15)22-17-8-9-21-19(17)20/h4-11H,1-3H3 |
| InChIKey | NRZWGEVFXDXRJJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|