C25H27NO — CID 59572426
10-(4-tert-butyl-2,6-dimethylphenyl)-3-methylphenoxazine (PubChem CID 59572426) has the molecular formula C25H27NO and a molecular weight of 357.50 g/mol. Its IUPAC name is 10-(4-tert-butyl-2,6-dimethylphenyl)-3-methylphenoxazine.
| Compound Name | 10-(4-tert-butyl-2,6-dimethylphenyl)-3-methylphenoxazine |
|---|---|
| PubChem CID | 59572426 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 10-(4-tert-butyl-2,6-dimethylphenyl)-3-methylphenoxazine |
| SMILES | Cc1ccc2c(c1)Oc1ccccc1N2c1c(C)cc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C25H27NO/c1-16-11-12-21-23(13-16)27-22-10-8-7-9-20(22)26(21)24-17(2)14-19(15-18(24)3)25(4,5)6/h7-15H,1-6H3 |
| InChIKey | JADGNCKJHKJSAK-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |