C26H29NS — CID 59184123
10-(4-tert-butyl-2,6-dimethylphenyl)-3,7-dimethylphenothiazine (PubChem CID 59184123) has the molecular formula C26H29NS and a molecular weight of 387.59 g/mol. Its IUPAC name is 10-(4-tert-butyl-2,6-dimethylphenyl)-3,7-dimethylphenothiazine.
| Compound Name | 10-(4-tert-butyl-2,6-dimethylphenyl)-3,7-dimethylphenothiazine |
|---|---|
| PubChem CID | 59184123 |
| Molecular Formula | C26H29NS |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 10-(4-tert-butyl-2,6-dimethylphenyl)-3,7-dimethylphenothiazine |
| SMILES | Cc1ccc2c(c1)Sc1cc(C)ccc1N2c1c(C)cc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C26H29NS/c1-16-8-10-21-23(12-16)28-24-13-17(2)9-11-22(24)27(21)25-18(3)14-20(15-19(25)4)26(5,6)7/h8-15H,1-7H3 |
| InChIKey | OCZAEJZQMGUAPX-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |