C46H53B2N — CID 153425022
11-tert-butyl-5,17-dimethyl-8,14-bis(2,3,4,5,6-pentamethylphenyl)-1-aza-8,14-diborapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 153425022) has the molecular formula C46H53B2N and a molecular weight of 641.56 g/mol. Its IUPAC name is 11-tert-butyl-5,17-dimethyl-8,14-bis(2,3,4,5,6-pentamethylphenyl)-1-aza-8,14-diborapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 11-tert-butyl-5,17-dimethyl-8,14-bis(2,3,4,5,6-pentamethylphenyl)-1-aza-8,14-diborapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 153425022 |
| Molecular Formula | C46H53B2N |
| Molecular Weight | 641.56 g/mol |
| Exact Mass | 641.44 |
| IUPAC Name | 11-tert-butyl-5,17-dimethyl-8,14-bis(2,3,4,5,6-pentamethylphenyl)-1-aza-8,14-diborapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | Cc1ccc2c(c1)B(c1c(C)c(C)c(C)c(C)c1C)c1cc(C(C)(C)C)cc3c1N2c1ccc(C)cc1B3c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C46H53B2N/c1-24-16-18-41-37(20-24)47(43-32(9)28(5)26(3)29(6)33(43)10)39-22-36(46(13,14)15)23-40-45(39)49(41)42-19-17-25(2)21-38(42)48(40)44-34(11)30(7)27(4)31(8)35(44)12/h16-23H,1-15H3 |
| InChIKey | JMFHLWRDPOXRBP-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.56 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|