C41H43B2N — CID 153424946
5,11,17-trimethyl-8,14-bis(2,3,4,6-tetramethylphenyl)-1-aza-8,14-diborapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 153424946) has the molecular formula C41H43B2N and a molecular weight of 571.43 g/mol. Its IUPAC name is 5,11,17-trimethyl-8,14-bis(2,3,4,6-tetramethylphenyl)-1-aza-8,14-diborapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 5,11,17-trimethyl-8,14-bis(2,3,4,6-tetramethylphenyl)-1-aza-8,14-diborapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 153424946 |
| Molecular Formula | C41H43B2N |
| Molecular Weight | 571.43 g/mol |
| Exact Mass | 571.36 |
| IUPAC Name | 5,11,17-trimethyl-8,14-bis(2,3,4,6-tetramethylphenyl)-1-aza-8,14-diborapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | Cc1ccc2c(c1)B(c1c(C)cc(C)c(C)c1C)c1cc(C)cc3c1N2c1ccc(C)cc1B3c1c(C)cc(C)c(C)c1C |
| InChI | InChI=1S/C41H43B2N/c1-22-12-14-37-33(16-22)42(39-27(6)20-25(4)29(8)31(39)10)35-18-24(3)19-36-41(35)44(37)38-15-13-23(2)17-34(38)43(36)40-28(7)21-26(5)30(9)32(40)11/h12-21H,1-11H3 |
| InChIKey | ONEMTXNQZWJMHO-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.43 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|