C32H32BN — CID 153159189
4,12,14,14-tetramethyl-8-(2,4,6-trimethylphenyl)-8-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaene (PubChem CID 153159189) has the molecular formula C32H32BN and a molecular weight of 441.43 g/mol. Its IUPAC name is 4,12,14,14-tetramethyl-8-(2,4,6-trimethylphenyl)-8-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaene.
| Compound Name | 4,12,14,14-tetramethyl-8-(2,4,6-trimethylphenyl)-8-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaene |
|---|---|
| PubChem CID | 153159189 |
| Molecular Formula | C32H32BN |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 4,12,14,14-tetramethyl-8-(2,4,6-trimethylphenyl)-8-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaene |
| SMILES | Cc1cc(C)c(N2c3ccc(C)cc3B3c4ccccc4C(C)(C)c4c(C)ccc2c43)c(C)c1 |
| InChI | InChI=1S/C32H32BN/c1-19-12-14-27-26(18-19)33-25-11-9-8-10-24(25)32(6,7)29-21(3)13-15-28(30(29)33)34(27)31-22(4)16-20(2)17-23(31)5/h8-18H,1-7H3 |
| InChIKey | WCAAALVSIWBZNR-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|