C42H38BNSn — CID 153424975
5,11,17-trimethyl-8,8-diphenyl-14-(2,4,6-trimethylphenyl)-1-aza-8-stanna-14-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene (PubChem CID 153424975) has the molecular formula C42H38BNSn and a molecular weight of 686.30 g/mol. Its IUPAC name is 5,11,17-trimethyl-8,8-diphenyl-14-(2,4,6-trimethylphenyl)-1-aza-8-stanna-14-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene.
| Compound Name | 5,11,17-trimethyl-8,8-diphenyl-14-(2,4,6-trimethylphenyl)-1-aza-8-stanna-14-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 153424975 |
| Molecular Formula | C42H38BNSn |
| Molecular Weight | 686.30 g/mol |
| Exact Mass | 687.21 |
| IUPAC Name | 5,11,17-trimethyl-8,8-diphenyl-14-(2,4,6-trimethylphenyl)-1-aza-8-stanna-14-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene |
| SMILES | Cc1cc(C)c(B2c3cc(C)ccc3N3c4ccc(C)cc4[Sn](c4ccccc4)(c4ccccc4)c4cc(C)cc2c43)c(C)c1 |
| InChI | InChI=1S/C30H28BN.2C6H5.Sn/c1-19-7-11-25(12-8-19)32-28-13-9-20(2)17-26(28)31(27-18-21(3)10-14-29(27)32)30-23(5)15-22(4)16-24(30)6;2*1-2-4-6-5-3-1;/h7-11,13,15-18H,1-6H3;2*1-5H; |
| InChIKey | ISJCTUZLNWEKFD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.30 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|