C16H14F3NS — CID 118593710
3,7-dimethyl-10-(2,2,2-trifluoroethyl)phenothiazine (PubChem CID 118593710) has the molecular formula C16H14F3NS and a molecular weight of 309.36 g/mol. Its IUPAC name is 3,7-dimethyl-10-(2,2,2-trifluoroethyl)phenothiazine.
| Compound Name | 3,7-dimethyl-10-(2,2,2-trifluoroethyl)phenothiazine |
|---|---|
| PubChem CID | 118593710 |
| Molecular Formula | C16H14F3NS |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 3,7-dimethyl-10-(2,2,2-trifluoroethyl)phenothiazine |
| SMILES | Cc1ccc2c(c1)Sc1cc(C)ccc1N2CC(F)(F)F |
| InChI | InChI=1S/C16H14F3NS/c1-10-3-5-12-14(7-10)21-15-8-11(2)4-6-13(15)20(12)9-16(17,18)19/h3-8H,9H2,1-2H3 |
| InChIKey | QXRWFUFPGNPPBU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |