C9H9BrF3N — CID 82757110
2-bromo-5-methyl-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 82757110) has the molecular formula C9H9BrF3N and a molecular weight of 268.08 g/mol. Its IUPAC name is 2-bromo-5-methyl-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 2-bromo-5-methyl-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 82757110 |
| Molecular Formula | C9H9BrF3N |
| Molecular Weight | 268.08 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 2-bromo-5-methyl-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | Cc1ccc(Br)c(NCC(F)(F)F)c1 |
| InChI | InChI=1S/C9H9BrF3N/c1-6-2-3-7(10)8(4-6)14-5-9(11,12)13/h2-4,14H,5H2,1H3 |
| InChIKey | SVJVAQXBMUTYKN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.08 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |