C9H7F6N — CID 11746827
N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)aniline (PubChem CID 11746827) has the molecular formula C9H7F6N and a molecular weight of 243.15 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)aniline.
| Compound Name | N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 11746827 |
| Molecular Formula | C9H7F6N |
| Molecular Weight | 243.15 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)CNc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H7F6N/c10-8(11,12)5-16-7-3-1-2-6(4-7)9(13,14)15/h1-4,16H,5H2 |
| InChIKey | OVIFIBWSSSOXLF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.15 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |