C18H13F6NO2S — CID 118595853
methyl 3-[3,7-bis(trifluoromethyl)phenothiazin-10-yl]propanoate (PubChem CID 118595853) has the molecular formula C18H13F6NO2S and a molecular weight of 421.36 g/mol. Its IUPAC name is methyl 3-[3,7-bis(trifluoromethyl)phenothiazin-10-yl]propanoate.
| Compound Name | methyl 3-[3,7-bis(trifluoromethyl)phenothiazin-10-yl]propanoate |
|---|---|
| PubChem CID | 118595853 |
| Molecular Formula | C18H13F6NO2S |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | methyl 3-[3,7-bis(trifluoromethyl)phenothiazin-10-yl]propanoate |
| SMILES | COC(=O)CCN1c2ccc(C(F)(F)F)cc2Sc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C18H13F6NO2S/c1-27-16(26)6-7-25-12-4-2-10(17(19,20)21)8-14(12)28-15-9-11(18(22,23)24)3-5-13(15)25/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | PBUIHHVRKJAFBR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |