C14H11F3N2O3 — CID 110449065
methyl 3-[1-cyano-3-oxo-6-(trifluoromethyl)-1H-isoindol-2-yl]propanoate (PubChem CID 110449065) has the molecular formula C14H11F3N2O3 and a molecular weight of 312.25 g/mol. Its IUPAC name is methyl 3-[1-cyano-3-oxo-6-(trifluoromethyl)-1H-isoindol-2-yl]propanoate.
| Compound Name | methyl 3-[1-cyano-3-oxo-6-(trifluoromethyl)-1H-isoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 110449065 |
| Molecular Formula | C14H11F3N2O3 |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | methyl 3-[1-cyano-3-oxo-6-(trifluoromethyl)-1H-isoindol-2-yl]propanoate |
| SMILES | COC(=O)CCN1C(=O)c2ccc(C(F)(F)F)cc2C1C#N |
| InChI | InChI=1S/C14H11F3N2O3/c1-22-12(20)4-5-19-11(7-18)10-6-8(14(15,16)17)2-3-9(10)13(19)21/h2-3,6,11H,4-5H2,1H3 |
| InChIKey | XWUQQMFSPNHGBW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |