C18H13F3N2O2 — CID 110449099
2-[(2-methoxyphenyl)methyl]-3-oxo-6-(trifluoromethyl)-1H-isoindole-1-carbonitrile (PubChem CID 110449099) has the molecular formula C18H13F3N2O2 and a molecular weight of 346.31 g/mol. Its IUPAC name is 2-[(2-methoxyphenyl)methyl]-3-oxo-6-(trifluoromethyl)-1H-isoindole-1-carbonitrile.
| Compound Name | 2-[(2-methoxyphenyl)methyl]-3-oxo-6-(trifluoromethyl)-1H-isoindole-1-carbonitrile |
|---|---|
| PubChem CID | 110449099 |
| Molecular Formula | C18H13F3N2O2 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2-[(2-methoxyphenyl)methyl]-3-oxo-6-(trifluoromethyl)-1H-isoindole-1-carbonitrile |
| SMILES | COc1ccccc1CN1C(=O)c2ccc(C(F)(F)F)cc2C1C#N |
| InChI | InChI=1S/C18H13F3N2O2/c1-25-16-5-3-2-4-11(16)10-23-15(9-22)14-8-12(18(19,20)21)6-7-13(14)17(23)24/h2-8,15H,10H2,1H3 |
| InChIKey | UGUKZXBDURPRMK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |