C20H23F3N2O — CID 1351397
1-[(2-methoxyphenyl)methyl]-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 1351397) has the molecular formula C20H23F3N2O and a molecular weight of 364.41 g/mol. Its IUPAC name is 1-[(2-methoxyphenyl)methyl]-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[(2-methoxyphenyl)methyl]-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 1351397 |
| Molecular Formula | C20H23F3N2O |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 1-[(2-methoxyphenyl)methyl]-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | COc1ccccc1CN1CCN(Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H23F3N2O/c1-26-19-5-3-2-4-17(19)15-25-12-10-24(11-13-25)14-16-6-8-18(9-7-16)20(21,22)23/h2-9H,10-15H2,1H3 |
| InChIKey | PTJLBFKMUFLXFK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |