C14H17N3O2 — CID 110448428
6-(dimethylamino)-2-(3-hydroxypropyl)-3-oxo-1H-isoindole-1-carbonitrile (PubChem CID 110448428) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 6-(dimethylamino)-2-(3-hydroxypropyl)-3-oxo-1H-isoindole-1-carbonitrile.
| Compound Name | 6-(dimethylamino)-2-(3-hydroxypropyl)-3-oxo-1H-isoindole-1-carbonitrile |
|---|---|
| PubChem CID | 110448428 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 6-(dimethylamino)-2-(3-hydroxypropyl)-3-oxo-1H-isoindole-1-carbonitrile |
| SMILES | CN(C)c1ccc2c(c1)C(C#N)N(CCCO)C2=O |
| InChI | InChI=1S/C14H17N3O2/c1-16(2)10-4-5-11-12(8-10)13(9-15)17(14(11)19)6-3-7-18/h4-5,8,13,18H,3,6-7H2,1-2H3 |
| InChIKey | WVZYMARTSXMSFC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |