C15H15N3O5 — CID 110448462
2-[1-cyano-6-(dimethylamino)-3-oxo-1H-isoindol-2-yl]butanedioic acid (PubChem CID 110448462) has the molecular formula C15H15N3O5 and a molecular weight of 317.30 g/mol. Its IUPAC name is 2-[1-cyano-6-(dimethylamino)-3-oxo-1H-isoindol-2-yl]butanedioic acid.
| Compound Name | 2-[1-cyano-6-(dimethylamino)-3-oxo-1H-isoindol-2-yl]butanedioic acid |
|---|---|
| PubChem CID | 110448462 |
| Molecular Formula | C15H15N3O5 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-[1-cyano-6-(dimethylamino)-3-oxo-1H-isoindol-2-yl]butanedioic acid |
| SMILES | CN(C)c1ccc2c(c1)C(C#N)N(C(CC(=O)O)C(=O)O)C2=O |
| InChI | InChI=1S/C15H15N3O5/c1-17(2)8-3-4-9-10(5-8)12(7-16)18(14(9)21)11(15(22)23)6-13(19)20/h3-5,11-12H,6H2,1-2H3,(H,19,20)(H,22,23) |
| InChIKey | DRHZENGNNBUVPE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 121.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |