methyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate

C23H17NO2S3 — CID 122390054

IUPACmethyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate
SMILESCOC(=O)CN1c2ccc(-c3cccs3)cc2Sc2cc(-c3cccs3)ccc21
InChIInChI=1S/C23H17NO2S3/c1-26-23(25)14-24-17-8-6-15(19-4-2-10-27-19)12-21(17)29-22-13-16(7-9-18(22)24)20-5-3-11-28-20/h2-13H,14H2,1H3
InChIKeyYYRFHJXUVQIOOK-UHFFFAOYSA-N
MW435.60 g/mol
LogP6.92
Rot. Bonds4

About methyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate

methyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate (PubChem CID 122390054) has the molecular formula C23H17NO2S3 and a molecular weight of 435.60 g/mol. Its IUPAC name is methyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate
PubChem CID122390054
Molecular FormulaC23H17NO2S3
Molecular Weight435.60 g/mol
Exact Mass435.04
IUPAC Namemethyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate
SMILESCOC(=O)CN1c2ccc(-c3cccs3)cc2Sc2cc(-c3cccs3)ccc21
InChIInChI=1S/C23H17NO2S3/c1-26-23(25)14-24-17-8-6-15(19-4-2-10-27-19)12-21(17)29-22-13-16(7-9-18(22)24)20-5-3-11-28-20/h2-13H,14H2,1H3
InChIKeyYYRFHJXUVQIOOK-UHFFFAOYSA-N
XLogP6.92
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms29
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500435.60
LogP ≤ 56.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate?
The IUPAC name of methyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate (CID 122390054) is methyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate.
What is the SMILES notation for methyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate?
The canonical SMILES for methyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate is COC(=O)CN1c2ccc(-c3cccs3)cc2Sc2cc(-c3cccs3)ccc21.
What is the InChIKey of methyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate?
The InChIKey is YYRFHJXUVQIOOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17NO2S3/c1-26-23(25)14-24-17-8-6-15(19-4-2-10-27-19)12-21(17)29-22-13-16(7-9-18(22)24)20-5-3-11-28-20/h2-13H,14H2,1H3.
What are the key properties of methyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate?
methyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate has a molecular weight of 435.60 g/mol, XLogP of 6.92, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate is sourced from PubChem (CID 122390054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).