C23H17NO2S3 — CID 122390054
methyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate (PubChem CID 122390054) has the molecular formula C23H17NO2S3 and a molecular weight of 435.60 g/mol. Its IUPAC name is methyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate.
| Compound Name | methyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate |
|---|---|
| PubChem CID | 122390054 |
| Molecular Formula | C23H17NO2S3 |
| Molecular Weight | 435.60 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | methyl 2-(3,7-dithiophen-2-ylphenothiazin-10-yl)acetate |
| SMILES | COC(=O)CN1c2ccc(-c3cccs3)cc2Sc2cc(-c3cccs3)ccc21 |
| InChI | InChI=1S/C23H17NO2S3/c1-26-23(25)14-24-17-8-6-15(19-4-2-10-27-19)12-21(17)29-22-13-16(7-9-18(22)24)20-5-3-11-28-20/h2-13H,14H2,1H3 |
| InChIKey | YYRFHJXUVQIOOK-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.60 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |