C16H19NS — CID 144583719
10-ethyl-2,7-dimethyl-2,3-dihydrophenothiazine (PubChem CID 144583719) has the molecular formula C16H19NS and a molecular weight of 257.40 g/mol. Its IUPAC name is 10-ethyl-2,7-dimethyl-2,3-dihydrophenothiazine.
| Compound Name | 10-ethyl-2,7-dimethyl-2,3-dihydrophenothiazine |
|---|---|
| PubChem CID | 144583719 |
| Molecular Formula | C16H19NS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 10-ethyl-2,7-dimethyl-2,3-dihydrophenothiazine |
| SMILES | CCN1C2=CC(C)CC=C2Sc2cc(C)ccc21 |
| InChI | InChI=1S/C16H19NS/c1-4-17-13-7-5-12(3)10-16(13)18-15-8-6-11(2)9-14(15)17/h5,7-11H,4,6H2,1-3H3 |
| InChIKey | AWPVCCDCSZLGDS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |