C25H25N2O3S2+ — CID 153091467
5-(3-ethyl-6-methyl-1,3-benzothiazol-2-ylidene)-3-(3-ethyl-6-methyl-6,7-dihydro-1,3-benzothiazol-3-ium-2-yl)-4-hydroxycyclopent-3-ene-1,2-dione (PubChem CID 153091467) has the molecular formula C25H25N2O3S2+ and a molecular weight of 465.62 g/mol. Its IUPAC name is 5-(3-ethyl-6-methyl-1,3-benzothiazol-2-ylidene)-3-(3-ethyl-6-methyl-6,7-dihydro-1,3-benzothiazol-3-ium-2-yl)-4-hydroxycyclopent-3-ene-1,2-dione.
| Compound Name | 5-(3-ethyl-6-methyl-1,3-benzothiazol-2-ylidene)-3-(3-ethyl-6-methyl-6,7-dihydro-1,3-benzothiazol-3-ium-2-yl)-4-hydroxycyclopent-3-ene-1,2-dione |
|---|---|
| PubChem CID | 153091467 |
| Molecular Formula | C25H25N2O3S2+ |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 5-(3-ethyl-6-methyl-1,3-benzothiazol-2-ylidene)-3-(3-ethyl-6-methyl-6,7-dihydro-1,3-benzothiazol-3-ium-2-yl)-4-hydroxycyclopent-3-ene-1,2-dione |
| SMILES | CCN1C(=C2C(=O)C(=O)C(c3sc4c([n+]3CC)C=CC(C)C4)=C2O)Sc2cc(C)ccc21 |
| InChI | InChI=1S/C25H24N2O3S2/c1-5-26-15-9-7-13(3)11-17(15)31-24(26)19-21(28)20(23(30)22(19)29)25-27(6-2)16-10-8-14(4)12-18(16)32-25/h7-11,14H,5-6,12H2,1-4H3/p+1 |
| InChIKey | VPFYOHPUQRDZNY-UHFFFAOYSA-O |
| XLogP | 4.83 |
| TPSA | 61.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|