C25H27IN2 — CID 171149843
1-ethyl-2-[(1-ethyl-6-methylquinolin-1-ium-2-yl)methylidene]-6-methylquinoline iodide (PubChem CID 171149843) has the molecular formula C25H27IN2 and a molecular weight of 482.41 g/mol. Its IUPAC name is 1-ethyl-2-[(1-ethyl-6-methylquinolin-1-ium-2-yl)methylidene]-6-methylquinoline iodide.
| Compound Name | 1-ethyl-2-[(1-ethyl-6-methylquinolin-1-ium-2-yl)methylidene]-6-methylquinoline iodide |
|---|---|
| PubChem CID | 171149843 |
| Molecular Formula | C25H27IN2 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 1-ethyl-2-[(1-ethyl-6-methylquinolin-1-ium-2-yl)methylidene]-6-methylquinoline iodide |
| SMILES | CCN1C(=Cc2ccc3cc(C)ccc3[n+]2CC)C=Cc2cc(C)ccc21.[I-] |
| InChI | InChI=1S/C25H27N2.HI/c1-5-26-22(11-9-20-15-18(3)7-13-24(20)26)17-23-12-10-21-16-19(4)8-14-25(21)27(23)6-2;/h7-17H,5-6H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | LTDMIWYMYDNEDZ-UHFFFAOYSA-M |
| XLogP | 2.66 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|