C23H25N2+ — CID 4069411
1-ethyl-6-methyl-2-[(1-methyl-4a,8a-dihydroquinolin-2-ylidene)methyl]quinolin-1-ium (PubChem CID 4069411) has the molecular formula C23H25N2+ and a molecular weight of 329.47 g/mol. Its IUPAC name is 1-ethyl-6-methyl-2-[(1-methyl-4a,8a-dihydroquinolin-2-ylidene)methyl]quinolin-1-ium.
| Compound Name | 1-ethyl-6-methyl-2-[(1-methyl-4a,8a-dihydroquinolin-2-ylidene)methyl]quinolin-1-ium |
|---|---|
| PubChem CID | 4069411 |
| Molecular Formula | C23H25N2+ |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 1-ethyl-6-methyl-2-[(1-methyl-4a,8a-dihydroquinolin-2-ylidene)methyl]quinolin-1-ium |
| SMILES | CC[n+]1c(C=C2C=CC3C=CC=CC3N2C)ccc2cc(C)ccc21 |
| InChI | InChI=1S/C23H25N2/c1-4-25-21(13-11-19-15-17(2)9-14-23(19)25)16-20-12-10-18-7-5-6-8-22(18)24(20)3/h5-16,18,22H,4H2,1-3H3/q+1 |
| InChIKey | XMKOIADQURDREY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|