C26H29N2O3S+ — CID 3146441
3-[2-[(1-ethyl-6-methylquinolin-1-ium-2-yl)methylidene]-7-methylquinolin-1-yl]propane-1-sulfonic acid (PubChem CID 3146441) has the molecular formula C26H29N2O3S+ and a molecular weight of 449.60 g/mol. Its IUPAC name is 3-[2-[(1-ethyl-6-methylquinolin-1-ium-2-yl)methylidene]-7-methylquinolin-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(1-ethyl-6-methylquinolin-1-ium-2-yl)methylidene]-7-methylquinolin-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 3146441 |
| Molecular Formula | C26H29N2O3S+ |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 3-[2-[(1-ethyl-6-methylquinolin-1-ium-2-yl)methylidene]-7-methylquinolin-1-yl]propane-1-sulfonic acid |
| SMILES | CC[n+]1c(C=C2C=Cc3ccc(C)cc3N2CCCS(=O)(=O)O)ccc2cc(C)ccc21 |
| InChI | InChI=1S/C26H28N2O3S/c1-4-27-23(12-10-22-16-19(2)7-13-25(22)27)18-24-11-9-21-8-6-20(3)17-26(21)28(24)14-5-15-32(29,30)31/h6-13,16-18H,4-5,14-15H2,1-3H3/p+1 |
| InChIKey | VDRDYKSAJYQTRY-UHFFFAOYSA-O |
| XLogP | 4.92 |
| TPSA | 61.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|