C32H33N2O7S2+ — CID 54014582
4-[2-[[1-[2-(4-methoxyphenyl)-2-sulfoethyl]quinolin-1-ium-2-yl]methylidene]quinolin-1-yl]butane-1-sulfonic acid (PubChem CID 54014582) has the molecular formula C32H33N2O7S2+ and a molecular weight of 621.76 g/mol. Its IUPAC name is 4-[2-[[1-[2-(4-methoxyphenyl)-2-sulfoethyl]quinolin-1-ium-2-yl]methylidene]quinolin-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[[1-[2-(4-methoxyphenyl)-2-sulfoethyl]quinolin-1-ium-2-yl]methylidene]quinolin-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 54014582 |
| Molecular Formula | C32H33N2O7S2+ |
| Molecular Weight | 621.76 g/mol |
| Exact Mass | 621.17 |
| IUPAC Name | 4-[2-[[1-[2-(4-methoxyphenyl)-2-sulfoethyl]quinolin-1-ium-2-yl]methylidene]quinolin-1-yl]butane-1-sulfonic acid |
| SMILES | COc1ccc(C(C[n+]2c(C=C3C=Cc4ccccc4N3CCCCS(=O)(=O)O)ccc3ccccc32)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C32H32N2O7S2/c1-41-29-18-14-26(15-19-29)32(43(38,39)40)23-34-28(17-13-25-9-3-5-11-31(25)34)22-27-16-12-24-8-2-4-10-30(24)33(27)20-6-7-21-42(35,36)37/h2-5,8-19,22,32H,6-7,20-21,23H2,1H3,(H-,35,36,37,38,39,40)/p+1 |
| InChIKey | YPUBAAWWYZWMQB-UHFFFAOYSA-O |
| XLogP | 5.31 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.76 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|