C36H44N4O2+2 — CID 158843380
3-oxo-4-[[1-[3-(trimethylazaniumyl)propyl]quinolin-1-ium-2-yl]methylidene]-2-[[1-[3-(trimethylazaniumyl)propyl]quinolin-2-ylidene]methyl]cyclobuten-1-olate (PubChem CID 158843380) has the molecular formula C36H44N4O2+2 and a molecular weight of 564.77 g/mol. Its IUPAC name is 3-oxo-4-[[1-[3-(trimethylazaniumyl)propyl]quinolin-1-ium-2-yl]methylidene]-2-[[1-[3-(trimethylazaniumyl)propyl]quinolin-2-ylidene]methyl]cyclobuten-1-olate.
| Compound Name | 3-oxo-4-[[1-[3-(trimethylazaniumyl)propyl]quinolin-1-ium-2-yl]methylidene]-2-[[1-[3-(trimethylazaniumyl)propyl]quinolin-2-ylidene]methyl]cyclobuten-1-olate |
|---|---|
| PubChem CID | 158843380 |
| Molecular Formula | C36H44N4O2+2 |
| Molecular Weight | 564.77 g/mol |
| Exact Mass | 564.35 |
| IUPAC Name | 3-oxo-4-[[1-[3-(trimethylazaniumyl)propyl]quinolin-1-ium-2-yl]methylidene]-2-[[1-[3-(trimethylazaniumyl)propyl]quinolin-2-ylidene]methyl]cyclobuten-1-olate |
| SMILES | C[N+](C)(C)CCCN1C(=CC2=C([O-])C(=Cc3ccc4ccccc4[n+]3CCC[N+](C)(C)C)C2=O)C=Cc2ccccc21 |
| InChI | InChI=1S/C36H44N4O2/c1-39(2,3)23-11-21-37-29(19-17-27-13-7-9-15-33(27)37)25-31-35(41)32(36(31)42)26-30-20-18-28-14-8-10-16-34(28)38(30)22-12-24-40(4,5)6/h7-10,13-20,25-26H,11-12,21-24H2,1-6H3/q+2 |
| InChIKey | IYNKBOQSVCSAJQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.77 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|