C21H21ClN2 — CID 71299279
1-methyl-2-[(Z)-(1-methyl-4a,8a-dihydroquinolin-2-ylidene)methyl]quinolin-1-ium chloride (PubChem CID 71299279) has the molecular formula C21H21ClN2 and a molecular weight of 336.87 g/mol. Its IUPAC name is 1-methyl-2-[(Z)-(1-methyl-4a,8a-dihydroquinolin-2-ylidene)methyl]quinolin-1-ium chloride.
| Compound Name | 1-methyl-2-[(Z)-(1-methyl-4a,8a-dihydroquinolin-2-ylidene)methyl]quinolin-1-ium chloride |
|---|---|
| PubChem CID | 71299279 |
| Molecular Formula | C21H21ClN2 |
| Molecular Weight | 336.87 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 1-methyl-2-[(Z)-(1-methyl-4a,8a-dihydroquinolin-2-ylidene)methyl]quinolin-1-ium chloride |
| SMILES | CN1/C(=C\c2ccc3ccccc3[n+]2C)C=CC2C=CC=CC21.[Cl-] |
| InChI | InChI=1S/C21H21N2.ClH/c1-22-18(13-11-16-7-3-5-9-20(16)22)15-19-14-12-17-8-4-6-10-21(17)23(19)2;/h3-16,20H,1-2H3;1H/q+1;/p-1 |
| InChIKey | XWDSBNNIKMEQHA-UHFFFAOYSA-M |
| XLogP | 0.62 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.87 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|