C20H18N+ — CID 54607794
1-methyl-2-[(1Z,3E)-4-phenylbuta-1,3-dienyl]quinolin-1-ium (PubChem CID 54607794) has the molecular formula C20H18N+ and a molecular weight of 272.37 g/mol. Its IUPAC name is 1-methyl-2-[(1Z,3E)-4-phenylbuta-1,3-dienyl]quinolin-1-ium.
| Compound Name | 1-methyl-2-[(1Z,3E)-4-phenylbuta-1,3-dienyl]quinolin-1-ium |
|---|---|
| PubChem CID | 54607794 |
| Molecular Formula | C20H18N+ |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 1-methyl-2-[(1Z,3E)-4-phenylbuta-1,3-dienyl]quinolin-1-ium |
| SMILES | C[n+]1c(/C=C\C=C\c2ccccc2)ccc2ccccc21 |
| InChI | InChI=1S/C20H18N/c1-21-19(16-15-18-12-6-8-14-20(18)21)13-7-5-11-17-9-3-2-4-10-17/h2-16H,1H3/q+1/b11-5+,13-7- |
| InChIKey | YQHOQSUNDCCKFO-RKLIXYOZSA-N |
| XLogP | 4.39 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|