C24H22ClN2O4+ — CID 126959042
N-[(1E,3E)-4-(1-methylquinolin-1-ium-2-yl)buta-1,3-dienyl]naphthalen-2-amine;perchloric acid (PubChem CID 126959042) has the molecular formula C24H22ClN2O4+ and a molecular weight of 437.90 g/mol. Its IUPAC name is N-[(1E,3E)-4-(1-methylquinolin-1-ium-2-yl)buta-1,3-dienyl]naphthalen-2-amine;perchloric acid.
| Compound Name | N-[(1E,3E)-4-(1-methylquinolin-1-ium-2-yl)buta-1,3-dienyl]naphthalen-2-amine;perchloric acid |
|---|---|
| PubChem CID | 126959042 |
| Molecular Formula | C24H22ClN2O4+ |
| Molecular Weight | 437.90 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N-[(1E,3E)-4-(1-methylquinolin-1-ium-2-yl)buta-1,3-dienyl]naphthalen-2-amine;perchloric acid |
| SMILES | C[n+]1c(/C=C/C=C/Nc2ccc3ccccc3c2)ccc2ccccc21.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C24H20N2.ClHO4/c1-26-23(16-14-20-9-4-5-12-24(20)26)11-6-7-17-25-22-15-13-19-8-2-3-10-21(19)18-22;2-1(3,4)5/h2-18H,1H3;(H,2,3,4,5)/p+1 |
| InChIKey | PITISWUHTZQGMH-UHFFFAOYSA-O |
| XLogP | 1.33 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.90 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|