C18H11F5N+ — CID 89289948
1-methyl-2-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]quinolin-1-ium (PubChem CID 89289948) has the molecular formula C18H11F5N+ and a molecular weight of 336.28 g/mol. Its IUPAC name is 1-methyl-2-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]quinolin-1-ium.
| Compound Name | 1-methyl-2-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]quinolin-1-ium |
|---|---|
| PubChem CID | 89289948 |
| Molecular Formula | C18H11F5N+ |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 1-methyl-2-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]quinolin-1-ium |
| SMILES | C[n+]1c(/C=C/c2c(F)c(F)c(F)c(F)c2F)ccc2ccccc21 |
| InChI | InChI=1S/C18H11F5N/c1-24-11(7-6-10-4-2-3-5-13(10)24)8-9-12-14(19)16(21)18(23)17(22)15(12)20/h2-9H,1H3/q+1/b9-8+ |
| InChIKey | YUWOTLTZGAATMC-CMDGGOBGSA-N |
| XLogP | 4.53 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|