C24H26NO+ — CID 67731349
2-ethyl-1-[4-[(E)-2-(1-methylquinolin-1-ium-2-yl)ethenyl]phenyl]butan-1-one (PubChem CID 67731349) has the molecular formula C24H26NO+ and a molecular weight of 344.48 g/mol. Its IUPAC name is 2-ethyl-1-[4-[(E)-2-(1-methylquinolin-1-ium-2-yl)ethenyl]phenyl]butan-1-one.
| Compound Name | 2-ethyl-1-[4-[(E)-2-(1-methylquinolin-1-ium-2-yl)ethenyl]phenyl]butan-1-one |
|---|---|
| PubChem CID | 67731349 |
| Molecular Formula | C24H26NO+ |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 2-ethyl-1-[4-[(E)-2-(1-methylquinolin-1-ium-2-yl)ethenyl]phenyl]butan-1-one |
| SMILES | CCC(CC)C(=O)c1ccc(/C=C/c2ccc3ccccc3[n+]2C)cc1 |
| InChI | InChI=1S/C24H26NO/c1-4-19(5-2)24(26)21-13-10-18(11-14-21)12-16-22-17-15-20-8-6-7-9-23(20)25(22)3/h6-17,19H,4-5H2,1-3H3/q+1/b16-12+ |
| InChIKey | NVNXYCIKABOITA-FOWTUZBSSA-N |
| XLogP | 5.45 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|