C54H50N4+2 — CID 175926944
2-[(E)-2-[4-[1-[4-[(E)-2-[6-(dimethylamino)-1-methylquinolin-1-ium-2-yl]ethenyl]phenyl]-2,2-diphenylethenyl]phenyl]ethenyl]-N,N,1-trimethylquinolin-1-ium-6-amine (PubChem CID 175926944) has the molecular formula C54H50N4+2 and a molecular weight of 755.02 g/mol. Its IUPAC name is 2-[(E)-2-[4-[1-[4-[(E)-2-[6-(dimethylamino)-1-methylquinolin-1-ium-2-yl]ethenyl]phenyl]-2,2-diphenylethenyl]phenyl]ethenyl]-N,N,1-trimethylquinolin-1-ium-6-amine.
| Compound Name | 2-[(E)-2-[4-[1-[4-[(E)-2-[6-(dimethylamino)-1-methylquinolin-1-ium-2-yl]ethenyl]phenyl]-2,2-diphenylethenyl]phenyl]ethenyl]-N,N,1-trimethylquinolin-1-ium-6-amine |
|---|---|
| PubChem CID | 175926944 |
| Molecular Formula | C54H50N4+2 |
| Molecular Weight | 755.02 g/mol |
| Exact Mass | 754.40 |
| IUPAC Name | 2-[(E)-2-[4-[1-[4-[(E)-2-[6-(dimethylamino)-1-methylquinolin-1-ium-2-yl]ethenyl]phenyl]-2,2-diphenylethenyl]phenyl]ethenyl]-N,N,1-trimethylquinolin-1-ium-6-amine |
| SMILES | CN(C)c1ccc2c(ccc(/C=C/c3ccc(C(=C(c4ccccc4)c4ccccc4)c4ccc(/C=C/c5ccc6cc(N(C)C)ccc6[n+]5C)cc4)cc3)[n+]2C)c1 |
| InChI | InChI=1S/C54H50N4/c1-55(2)49-33-35-51-45(37-49)27-31-47(57(51)5)29-21-39-17-23-43(24-18-39)54(53(41-13-9-7-10-14-41)42-15-11-8-12-16-42)44-25-19-40(20-26-44)22-30-48-32-28-46-38-50(56(3)4)34-36-52(46)58(48)6/h7-38H,1-6H3/q+2/b29-21+,30-22+ |
| InChIKey | ZOAWUEROHJGBDK-VFIVCBTMSA-N |
| XLogP | 11.12 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.02 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|