C24H24IN3 — CID 18527614
4-[(E)-2-(4,8-dimethyl-4,7-phenanthrolin-4-ium-3-yl)ethenyl]-N,N-dimethylaniline iodide (PubChem CID 18527614) has the molecular formula C24H24IN3 and a molecular weight of 481.38 g/mol. Its IUPAC name is 4-[(E)-2-(4,8-dimethyl-4,7-phenanthrolin-4-ium-3-yl)ethenyl]-N,N-dimethylaniline iodide.
| Compound Name | 4-[(E)-2-(4,8-dimethyl-4,7-phenanthrolin-4-ium-3-yl)ethenyl]-N,N-dimethylaniline iodide |
|---|---|
| PubChem CID | 18527614 |
| Molecular Formula | C24H24IN3 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 4-[(E)-2-(4,8-dimethyl-4,7-phenanthrolin-4-ium-3-yl)ethenyl]-N,N-dimethylaniline iodide |
| SMILES | Cc1ccc2c(ccc3c2ccc(/C=C/c2ccc(N(C)C)cc2)[n+]3C)n1.[I-] |
| InChI | InChI=1S/C24H24N3.HI/c1-17-5-13-21-22-14-12-20(27(4)24(22)16-15-23(21)25-17)11-8-18-6-9-19(10-7-18)26(2)3;/h5-16H,1-4H3;1H/q+1;/p-1 |
| InChIKey | PQCDBHKAXUDPCZ-UHFFFAOYSA-M |
| XLogP | 1.76 |
| TPSA | 20.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|