C22H25N2O3S3+ — CID 76636027
2-[(1-ethyl-6-methylquinolin-1-ium-2-yl)methylidene]-5,6-dimethyl-3-[2-(trioxidanylsulfanyl)ethyl]thieno[2,3-d][1,3]thiazole (PubChem CID 76636027) has the molecular formula C22H25N2O3S3+ and a molecular weight of 461.65 g/mol. Its IUPAC name is 2-[(1-ethyl-6-methylquinolin-1-ium-2-yl)methylidene]-5,6-dimethyl-3-[2-(trioxidanylsulfanyl)ethyl]thieno[2,3-d][1,3]thiazole.
| Compound Name | 2-[(1-ethyl-6-methylquinolin-1-ium-2-yl)methylidene]-5,6-dimethyl-3-[2-(trioxidanylsulfanyl)ethyl]thieno[2,3-d][1,3]thiazole |
|---|---|
| PubChem CID | 76636027 |
| Molecular Formula | C22H25N2O3S3+ |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 2-[(1-ethyl-6-methylquinolin-1-ium-2-yl)methylidene]-5,6-dimethyl-3-[2-(trioxidanylsulfanyl)ethyl]thieno[2,3-d][1,3]thiazole |
| SMILES | CC[n+]1c(C=C2Sc3c(sc(C)c3C)N2CCSOOO)ccc2cc(C)ccc21 |
| InChI | InChI=1S/C22H24N2O3S3/c1-5-23-18(8-7-17-12-14(2)6-9-19(17)23)13-20-24(10-11-28-27-26-25)22-21(30-20)15(3)16(4)29-22/h6-9,12-13H,5,10-11H2,1-4H3/p+1 |
| InChIKey | XZMQOLTXZUUKCQ-UHFFFAOYSA-O |
| XLogP | 6.11 |
| TPSA | 45.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|