C23H21N2S2+ — CID 3149295
2-[(1-ethyl-6-methylquinolin-1-ium-2-yl)methylidene]-1-methylthieno[3,2-e][1,3]benzothiazole (PubChem CID 3149295) has the molecular formula C23H21N2S2+ and a molecular weight of 389.57 g/mol. Its IUPAC name is 2-[(1-ethyl-6-methylquinolin-1-ium-2-yl)methylidene]-1-methylthieno[3,2-e][1,3]benzothiazole.
| Compound Name | 2-[(1-ethyl-6-methylquinolin-1-ium-2-yl)methylidene]-1-methylthieno[3,2-e][1,3]benzothiazole |
|---|---|
| PubChem CID | 3149295 |
| Molecular Formula | C23H21N2S2+ |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 2-[(1-ethyl-6-methylquinolin-1-ium-2-yl)methylidene]-1-methylthieno[3,2-e][1,3]benzothiazole |
| SMILES | CC[n+]1c(C=C2Sc3ccc4sccc4c3N2C)ccc2cc(C)ccc21 |
| InChI | InChI=1S/C23H21N2S2/c1-4-25-17(7-6-16-13-15(2)5-8-19(16)25)14-22-24(3)23-18-11-12-26-20(18)9-10-21(23)27-22/h5-14H,4H2,1-3H3/q+1 |
| InChIKey | SNRIYVUITWPMMQ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|