C23H25IN2O2S — CID 158804458
3-ethyl-2-[(1-ethyl-6-methoxyquinolin-1-ium-2-yl)methylidene]-5-methoxy-1,3-benzothiazole iodide (PubChem CID 158804458) has the molecular formula C23H25IN2O2S and a molecular weight of 520.44 g/mol. Its IUPAC name is 3-ethyl-2-[(1-ethyl-6-methoxyquinolin-1-ium-2-yl)methylidene]-5-methoxy-1,3-benzothiazole iodide.
| Compound Name | 3-ethyl-2-[(1-ethyl-6-methoxyquinolin-1-ium-2-yl)methylidene]-5-methoxy-1,3-benzothiazole iodide |
|---|---|
| PubChem CID | 158804458 |
| Molecular Formula | C23H25IN2O2S |
| Molecular Weight | 520.44 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | 3-ethyl-2-[(1-ethyl-6-methoxyquinolin-1-ium-2-yl)methylidene]-5-methoxy-1,3-benzothiazole iodide |
| SMILES | CCN1C(=Cc2ccc3cc(OC)ccc3[n+]2CC)Sc2ccc(OC)cc21.[I-] |
| InChI | InChI=1S/C23H25N2O2S.HI/c1-5-24-17(8-7-16-13-18(26-3)9-11-20(16)24)14-23-25(6-2)21-15-19(27-4)10-12-22(21)28-23;/h7-15H,5-6H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | RFWRRCFVBUSVQB-UHFFFAOYSA-M |
| XLogP | 2.10 |
| TPSA | 25.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|