C22H23N2OSe+ — CID 3621482
3-ethyl-2-[(1-ethyl-6-methoxyquinolin-1-ium-2-yl)methylidene]-1,3-benzoselenazole (PubChem CID 3621482) has the molecular formula C22H23N2OSe+ and a molecular weight of 410.40 g/mol. Its IUPAC name is 3-ethyl-2-[(1-ethyl-6-methoxyquinolin-1-ium-2-yl)methylidene]-1,3-benzoselenazole.
| Compound Name | 3-ethyl-2-[(1-ethyl-6-methoxyquinolin-1-ium-2-yl)methylidene]-1,3-benzoselenazole |
|---|---|
| PubChem CID | 3621482 |
| Molecular Formula | C22H23N2OSe+ |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 3-ethyl-2-[(1-ethyl-6-methoxyquinolin-1-ium-2-yl)methylidene]-1,3-benzoselenazole |
| SMILES | CCN1C(=Cc2ccc3cc(OC)ccc3[n+]2CC)[Se]c2ccccc21 |
| InChI | InChI=1S/C22H23N2OSe/c1-4-23-17(11-10-16-14-18(25-3)12-13-19(16)23)15-22-24(5-2)20-8-6-7-9-21(20)26-22/h6-15H,4-5H2,1-3H3/q+1 |
| InChIKey | SZHATTMMLFAGSV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|