C21H21N2Se+ — CID 53422461
3-ethyl-2-[(1-ethylquinolin-1-ium-4-yl)methylidene]-1,3-benzoselenazole (PubChem CID 53422461) has the molecular formula C21H21N2Se+ and a molecular weight of 380.37 g/mol. Its IUPAC name is 3-ethyl-2-[(1-ethylquinolin-1-ium-4-yl)methylidene]-1,3-benzoselenazole.
| Compound Name | 3-ethyl-2-[(1-ethylquinolin-1-ium-4-yl)methylidene]-1,3-benzoselenazole |
|---|---|
| PubChem CID | 53422461 |
| Molecular Formula | C21H21N2Se+ |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 3-ethyl-2-[(1-ethylquinolin-1-ium-4-yl)methylidene]-1,3-benzoselenazole |
| SMILES | CCN1C(=Cc2cc[n+](CC)c3ccccc23)[Se]c2ccccc21 |
| InChI | InChI=1S/C21H21N2Se/c1-3-22-14-13-16(17-9-5-6-10-18(17)22)15-21-23(4-2)19-11-7-8-12-20(19)24-21/h5-15H,3-4H2,1-2H3/q+1 |
| InChIKey | MBKHBSPNNXWKKH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|