C25H27N2O2Se2+ — CID 177430740
(2E)-3-ethyl-2-[(2E,4E)-5-(3-ethyl-5-methoxy-1,3-benzoselenazol-3-ium-2-yl)penta-2,4-dienylidene]-5-methoxy-1,3-benzoselenazole (PubChem CID 177430740) has the molecular formula C25H27N2O2Se2+ and a molecular weight of 545.42 g/mol. Its IUPAC name is (2E)-3-ethyl-2-[(2E,4E)-5-(3-ethyl-5-methoxy-1,3-benzoselenazol-3-ium-2-yl)penta-2,4-dienylidene]-5-methoxy-1,3-benzoselenazole.
| Compound Name | (2E)-3-ethyl-2-[(2E,4E)-5-(3-ethyl-5-methoxy-1,3-benzoselenazol-3-ium-2-yl)penta-2,4-dienylidene]-5-methoxy-1,3-benzoselenazole |
|---|---|
| PubChem CID | 177430740 |
| Molecular Formula | C25H27N2O2Se2+ |
| Molecular Weight | 545.42 g/mol |
| Exact Mass | 547.04 |
| IUPAC Name | (2E)-3-ethyl-2-[(2E,4E)-5-(3-ethyl-5-methoxy-1,3-benzoselenazol-3-ium-2-yl)penta-2,4-dienylidene]-5-methoxy-1,3-benzoselenazole |
| SMILES | CCN1/C(=C\C=C\C=C\c2[se]c3ccc(OC)cc3[n+]2CC)[Se]c2ccc(OC)cc21 |
| InChI | InChI=1S/C25H27N2O2Se2/c1-5-26-20-16-18(28-3)12-14-22(20)30-24(26)10-8-7-9-11-25-27(6-2)21-17-19(29-4)13-15-23(21)31-25/h7-17H,5-6H2,1-4H3/q+1 |
| InChIKey | AHNLYFSPKBFUFF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 25.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|