C32H31IN4OSe2 — CID 137092563
(2Z)-3-ethyl-2-[(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)methylidene]-5-[2-(3-ethyl-1,3-benzoselenazol-2-ylidene)ethylidene]-1-phenylimidazolidin-4-one iodide (PubChem CID 137092563) has the molecular formula C32H31IN4OSe2 and a molecular weight of 772.45 g/mol. Its IUPAC name is (2Z)-3-ethyl-2-[(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)methylidene]-5-[2-(3-ethyl-1,3-benzoselenazol-2-ylidene)ethylidene]-1-phenylimidazolidin-4-one iodide.
| Compound Name | (2Z)-3-ethyl-2-[(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)methylidene]-5-[2-(3-ethyl-1,3-benzoselenazol-2-ylidene)ethylidene]-1-phenylimidazolidin-4-one iodide |
|---|---|
| PubChem CID | 137092563 |
| Molecular Formula | C32H31IN4OSe2 |
| Molecular Weight | 772.45 g/mol |
| Exact Mass | 773.99 |
| IUPAC Name | (2Z)-3-ethyl-2-[(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)methylidene]-5-[2-(3-ethyl-1,3-benzoselenazol-2-ylidene)ethylidene]-1-phenylimidazolidin-4-one iodide |
| SMILES | CCN1C(=CC=c2c(=O)n(CC)/c(=C\c3[se]c4ccccc4[n+]3CC)n2-c2ccccc2)[Se]c2ccccc21.[I-] |
| InChI | InChI=1S/C32H31N4OSe2.HI/c1-4-33-24-16-10-12-18-27(24)38-30(33)21-20-26-32(37)35(6-3)29(36(26)23-14-8-7-9-15-23)22-31-34(5-2)25-17-11-13-19-28(25)39-31;/h7-22H,4-6H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | BDDKZXTYLKCYSK-UHFFFAOYSA-M |
| XLogP | -0.50 |
| TPSA | 34.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.45 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|