C25H26N2O8SSe2 — CID 135001212
hydrogen sulfate;methyl 3-[(2E)-2-[(E)-3-[3-(3-methoxy-3-oxopropyl)-1,3-benzoselenazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzoselenazol-3-yl]propanoate (PubChem CID 135001212) has the molecular formula C25H26N2O8SSe2 and a molecular weight of 672.48 g/mol. Its IUPAC name is hydrogen sulfate;methyl 3-[(2E)-2-[(E)-3-[3-(3-methoxy-3-oxopropyl)-1,3-benzoselenazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzoselenazol-3-yl]propanoate.
| Compound Name | hydrogen sulfate;methyl 3-[(2E)-2-[(E)-3-[3-(3-methoxy-3-oxopropyl)-1,3-benzoselenazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzoselenazol-3-yl]propanoate |
|---|---|
| PubChem CID | 135001212 |
| Molecular Formula | C25H26N2O8SSe2 |
| Molecular Weight | 672.48 g/mol |
| Exact Mass | 673.97 |
| IUPAC Name | hydrogen sulfate;methyl 3-[(2E)-2-[(E)-3-[3-(3-methoxy-3-oxopropyl)-1,3-benzoselenazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzoselenazol-3-yl]propanoate |
| SMILES | COC(=O)CCN1/C(=C\C=C\c2[se]c3ccccc3[n+]2CCC(=O)OC)[Se]c2ccccc21.O=S(=O)([O-])O |
| InChI | InChI=1S/C25H25N2O4Se2.H2O4S/c1-30-24(28)14-16-26-18-8-3-5-10-20(18)32-22(26)12-7-13-23-27(17-15-25(29)31-2)19-9-4-6-11-21(19)33-23;1-5(2,3)4/h3-13H,14-17H2,1-2H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | HTGYGHLQSWGQPO-UHFFFAOYSA-M |
| XLogP | 1.02 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.48 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|