C25H27N2Se2+ — CID 86138449
3,4-diethyl-2-[5-(3-ethyl-1,3-benzoselenazol-2-ylidene)penta-1,3-dienyl]-1,3-benzoselenazol-3-ium (PubChem CID 86138449) has the molecular formula C25H27N2Se2+ and a molecular weight of 513.43 g/mol. Its IUPAC name is 3,4-diethyl-2-[5-(3-ethyl-1,3-benzoselenazol-2-ylidene)penta-1,3-dienyl]-1,3-benzoselenazol-3-ium.
| Compound Name | 3,4-diethyl-2-[5-(3-ethyl-1,3-benzoselenazol-2-ylidene)penta-1,3-dienyl]-1,3-benzoselenazol-3-ium |
|---|---|
| PubChem CID | 86138449 |
| Molecular Formula | C25H27N2Se2+ |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 515.05 |
| IUPAC Name | 3,4-diethyl-2-[5-(3-ethyl-1,3-benzoselenazol-2-ylidene)penta-1,3-dienyl]-1,3-benzoselenazol-3-ium |
| SMILES | CCc1cccc2[se]c(C=CC=CC=C3[Se]c4ccccc4N3CC)[n+](CC)c12 |
| InChI | InChI=1S/C25H27N2Se2/c1-4-19-13-12-16-22-25(19)27(6-3)24(29-22)18-9-7-8-17-23-26(5-2)20-14-10-11-15-21(20)28-23/h7-18H,4-6H2,1-3H3/q+1 |
| InChIKey | DDYSVMVPVOBJRO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|